ChemNet > CAS > 6760-14-1 2-Amino-5-nitronicotinic acid
6760-14-1 2-Amino-5-nitronicotinic acid
상품명칭 |
2-Amino-5-nitronicotinic acid |
별명 |
2-amino-5-nitropyridine-3-carboxylic acid |
분자식 |
C6H5N3O4 |
분자량 |
183.1216 |
InChI |
InChI=1/C6H5N3O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H2,7,8)(H,10,11) |
cas번호 |
6760-14-1 |
분자 구조 |
|
밀도 |
1.675g/cm3 |
비등점 |
457.4°C at 760 mmHg |
굴절 지수 |
1.695 |
인화점 |
230.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|