ChemNet > CAS > 68220-26-8 2-Chloro-6-fluorobenzyl bromide
68220-26-8 2-Chloro-6-fluorobenzyl bromide
상품명칭 |
2-Chloro-6-fluorobenzyl bromide |
영문 이름 |
2-Chloro-6-fluorobenzyl bromide; alpha-Bromo-2-chloro-6-fluorotoluene; 2-(bromomethyl)-1-chloro-3-fluorobenzene |
분자식 |
C7H5BrClF |
분자량 |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
cas번호 |
68220-26-8 |
분자 구조 |
|
밀도 |
1.654g/cm3 |
비등점 |
222°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
88.1°C |
증기압 |
0.155mmHg at 25°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|