ChemNet > CAS > 6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
| 상품명칭 |
2-Chloro-N-(2,6-diethylphenyl)-acetamide |
| 영문 이름 |
2-Chloro-N-(2,6-diethylphenyl)-acetamide; N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
| 분자식 |
C12H16ClNO |
| 분자량 |
225.7145 |
| InChI |
InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| cas번호 |
6967-29-9 |
| 분자 구조 |
|
| 밀도 |
1.131g/cm3 |
| 비등점 |
369.2°C at 760 mmHg |
| 굴절 지수 |
1.559 |
| 인화점 |
177.1°C |
| 증기압 |
1.2E-05mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|