ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
상품명칭 |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
별명 |
Methyl 2,5-dimethylpyrrole-3-carboxylate |
분자식 |
C8H11NO2 |
분자량 |
153.1784 |
InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
cas번호 |
69687-80-5 |
분자 구조 |
|
밀도 |
1.108g/cm3 |
녹는 점 |
115℃ |
비등점 |
294.3°C at 760 mmHg |
굴절 지수 |
1.521 |
인화점 |
131.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|