698-76-0 Octanolactone
상품명칭 |
Octanolactone |
영문 이름 |
Octanolactone; 5-Hydroxyoctanoic acid lactone; delta-Octalactone; 1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one; Delta Octalactone |
분자식 |
C8H14O2 |
분자량 |
142.1956 |
InChI |
InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
cas번호 |
698-76-0 |
EC번호 |
211-820-5 |
분자 구조 |
|
밀도 |
0.96g/cm3 |
비등점 |
239.8°C at 760 mmHg |
굴절 지수 |
1.436 |
인화점 |
92.2°C |
증기압 |
0.0394mmHg at 25°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|