ChemNet > CAS > 71022-43-0 3,5-Dinitrobenzyl alcohol
71022-43-0 3,5-Dinitrobenzyl alcohol
상품명칭 |
3,5-Dinitrobenzyl alcohol |
별명 |
(3,5-dinitrophenyl)methanol |
분자식 |
C7H6N2O5 |
분자량 |
198.1329 |
InChI |
InChI=1/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 |
cas번호 |
71022-43-0 |
EC번호 |
275-131-1 |
분자 구조 |
|
밀도 |
1.56g/cm3 |
녹는 점 |
88-92℃ |
비등점 |
404.2°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
183.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|