ChemNet > CAS > 712-97-0 6-Nitropiperonal
712-97-0 6-Nitropiperonal
상품명칭 |
6-Nitropiperonal |
별명 |
(3,4-Methylenedioxy-6-nitrobenzald; 4,5-Methylenedioxy-2-nitrobenzaldehyde; 6-Nitro-1,3-benzodioxole-5-carboxaldehyde; 6-nitro-1,3-benzodioxole-5-carbaldehyde; 4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
분자식 |
C8H5NO5 |
분자량 |
195.129 |
InChI |
InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
cas번호 |
712-97-0 |
EC번호 |
211-926-1 |
분자 구조 |
|
밀도 |
1.572g/cm3 |
녹는 점 |
93-96℃ |
비등점 |
365.9°C at 760 mmHg |
굴절 지수 |
1.658 |
인화점 |
195°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|