ChemNet > CAS > 7144-65-2 2-Biphenylyl glycidyl ether
7144-65-2 2-Biphenylyl glycidyl ether
| 상품명칭 |
2-Biphenylyl glycidyl ether |
| 별명 |
3-(2-Biphenylyloxy)-1,2-epoxypropane; biphenyl-2-yl 2,3-epoxypropyl ether; ortho-phenylphenolglycidylether; 2-((1,1'-biphenyl-2-yloxy)methyl)-oxiran ; 3-(2-biphenyloxy)propylene oxide; 3-(2-xenyloxy)propylene oxide; 1-(2-biphenylyloxy)-2,3-epoxy-propan; 1-(Biphenyloxy)-2,3-epoxypropane; 2-[(biphenyl-2-yloxy)methyl]oxirane; (2S)-2-[(biphenyl-2-yloxy)methyl]oxirane; (2R)-2-[(biphenyl-2-yloxy)methyl]oxirane |
| 분자식 |
C15H14O2 |
| 분자량 |
226.2705 |
| InChI |
InChI=1/C15H14O2/c1-2-6-12(7-3-1)14-8-4-5-9-15(14)17-11-13-10-16-13/h1-9,13H,10-11H2/t13-/m1/s1 |
| cas번호 |
7144-65-2 |
| EC번호 |
230-451-0 |
| 분자 구조 |
|
| 밀도 |
1.136g/cm3 |
| 녹는 점 |
30-32℃ |
| 비등점 |
371°C at 760 mmHg |
| 굴절 지수 |
1.581 |
| 인화점 |
137.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
