ChemNet > CAS > 7151-68-0 3-Methoxy-4-methylbenzoic acid
7151-68-0 3-Methoxy-4-methylbenzoic acid
상품명칭 |
3-Methoxy-4-methylbenzoic acid |
영문 이름 |
3-Methoxy-4-methylbenzoic acid; 4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid~4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid (COOH=1); 3-methoxy-4-methylbenzoate |
분자식 |
C9H9O3 |
분자량 |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5H,1-2H3,(H,10,11)/p-1 |
cas번호 |
7151-68-0 |
EC번호 |
230-486-1 |
분자 구조 |
|
녹는 점 |
152-154℃ |
비등점 |
309.9°C at 760 mmHg |
인화점 |
126.2°C |
증기압 |
0.000267mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:;
|
|