ChemNet > CAS > 7295-44-5 p-Bromovalerophenone
7295-44-5 p-Bromovalerophenone
상품명칭 |
p-Bromovalerophenone |
별명 |
4'-bromovalerophenone; 1-(4-Bromophenyl)pentan-1-one; 1-pentanone, 1-(4-bromophenyl)-; p-Bromophenyl butyl ketone |
분자식 |
C11H13BrO |
분자량 |
241.1243 |
InChI |
InChI=1/C11H13BrO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
cas번호 |
7295-44-5 |
EC번호 |
230-729-1 |
분자 구조 |
|
밀도 |
1.291g/cm3 |
녹는 점 |
34-36℃ |
비등점 |
291.3°C at 760 mmHg |
굴절 지수 |
1.532 |
인화점 |
59.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|