ChemNet > CAS > 73033-58-6 5-Chloro-2-nitrobenzyl alcohol
73033-58-6 5-Chloro-2-nitrobenzyl alcohol
상품명칭 |
5-Chloro-2-nitrobenzyl alcohol |
별명 |
(5-chloro-2-nitrophenyl)methanol; 5-Chloro-2-nitrobenzenemethanol |
분자식 |
C7H6ClNO3 |
분자량 |
187.5804 |
InChI |
InChI=1/C7H6ClNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-3,10H,4H2 |
cas번호 |
73033-58-6 |
EC번호 |
277-241-5 |
분자 구조 |
|
밀도 |
1.476g/cm3 |
녹는 점 |
77-82℃ |
비등점 |
316.1°C at 760 mmHg |
굴절 지수 |
1.611 |
인화점 |
145°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|