ChemNet > CAS > 73357-18-3 4,5-Dimethoxy-2-nitrophenylacetic acid
73357-18-3 4,5-Dimethoxy-2-nitrophenylacetic acid
상품명칭 |
4,5-Dimethoxy-2-nitrophenylacetic acid |
별명 |
2-(4,5-Dimethoxy-2-nitrophenyl)acetic acid; (4,5-dimethoxy-2-nitrophenyl)acetate |
분자식 |
C10H10NO6 |
분자량 |
240.19 |
InChI |
InChI=1/C10H11NO6/c1-16-8-3-6(4-10(12)13)7(11(14)15)5-9(8)17-2/h3,5H,4H2,1-2H3,(H,12,13)/p-1 |
cas번호 |
73357-18-3 |
분자 구조 |
|
녹는 점 |
206-208℃ |
비등점 |
433.4°C at 760 mmHg |
인화점 |
215.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|