ChemNet > CAS > 7541-49-3 Phytol
7541-49-3 Phytol
상품명칭 |
Phytol |
별명 |
2-hexadecen-1-ol, 3,7,11,15-tetramethyl-; 3,7,11,15-Tetramethylhexadec-2-en-1-ol |
분자식 |
C20H40O |
분자량 |
296.531 |
InChI |
InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3 |
cas번호 |
7541-49-3 |
분자 구조 |
|
밀도 |
0.845g/cm3 |
비등점 |
335.5°C at 760 mmHg |
굴절 지수 |
1.459 |
인화점 |
157.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|