ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
상품명칭 |
methyl pentafluorobenzene |
별명 |
2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
분자식 |
C7H3F5 |
분자량 |
182.09 |
InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
cas번호 |
771-56-2 |
EC번호 |
212-233-7 |
분자 구조 |
|
밀도 |
1.44 |
비등점 |
117℃ |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|