ChemNet > CAS > 85684-64-6 2-(difluoromethoxy)benzyl bromide
85684-64-6 2-(difluoromethoxy)benzyl bromide
| 상품명칭 |
2-(difluoromethoxy)benzyl bromide |
| 별명 |
alpha-Bromo-2-difluoromethoxytoluene; 1-(bromomethyl)-2-(difluoromethoxy)benzene |
| 분자식 |
C8H7BrF2O |
| 분자량 |
237.0414 |
| InChI |
InChI=1/C8H7BrF2O/c9-5-6-3-1-2-4-7(6)12-8(10)11/h1-4,8H,5H2 |
| cas번호 |
85684-64-6 |
| 분자 구조 |
|
| 밀도 |
1.537g/cm3 |
| 비등점 |
225.2°C at 760 mmHg |
| 굴절 지수 |
1.506 |
| 인화점 |
108.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
