ChemNet > CAS > 871-78-3 N,N'-Diacetylethylenediamine
871-78-3 N,N'-Diacetylethylenediamine
| 상품명칭 |
N,N'-Diacetylethylenediamine |
| 별명 |
N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
| 분자식 |
C6H12N2O2 |
| 분자량 |
144.1717 |
| InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| cas번호 |
871-78-3 |
| EC번호 |
212-811-9 |
| 분자 구조 |
|
| 밀도 |
1.033g/cm3 |
| 비등점 |
438.7°C at 760 mmHg |
| 굴절 지수 |
1.444 |
| 인화점 |
214.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
