ChemNet > CAS > 89466-08-0 2-Hydroxybenzeneboronic acid
89466-08-0 2-Hydroxybenzeneboronic acid
상품명칭 |
2-Hydroxybenzeneboronic acid |
영문 이름 |
2-Hydroxybenzeneboronic acid; 2-Boronophenol; 2-Hydroxyphenylboronic acid |
분자식 |
C6H7BO3 |
분자량 |
137.929 |
InChI |
InChI=1/C6H7BO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8-10H |
cas번호 |
89466-08-0 |
분자 구조 |
|
밀도 |
1.32g/cm3 |
비등점 |
327.3°C at 760 mmHg |
굴절 지수 |
1.582 |
인화점 |
151.7°C |
증기압 |
8.28E-05mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|