ChemNet > CAS > 95-26-1 2,5-Dimethylbenzothiazole
95-26-1 2,5-Dimethylbenzothiazole
상품명칭 |
2,5-Dimethylbenzothiazole |
별명 |
Benzothiazole, 2,5-dimethyl-; 2,5-Dimethylbenzthiazol; 2,5-Dimethylbenzthiazol [Czech]; 4-27-00-01101 (Beilstein Handbook Reference); BRN 0116455; 2,5-dimethyl-1,3-benzothiazole |
분자식 |
C9H9NS |
분자량 |
163.2395 |
InChI |
InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
cas번호 |
95-26-1 |
EC번호 |
202-404-4 |
분자 구조 |
|
밀도 |
1.176g/cm3 |
녹는 점 |
36-40℃ |
비등점 |
259.4°C at 760 mmHg |
굴절 지수 |
1.643 |
인화점 |
112.7°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|