ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
Nama produk |
3-Iodophenylacetonitrile |
Sinonim |
3-Iodobenzyl cyanide |
MF |
C8H6IN |
Berat Molekul |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
CAS NO |
130723-54-5 |
Struktur Molekul |
|
Kepadatan |
1.764g/cm3 |
Titik didih |
308.6°C at 760 mmHg |
Indeks bias |
1.624 |
Titik nyala |
140.4°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|