ChemNet > CAS > 32863-31-3 5-(bromomethyl)-2,1,3-benzoxadiazole
32863-31-3 5-(bromomethyl)-2,1,3-benzoxadiazole
| Nama produk |
5-(bromomethyl)-2,1,3-benzoxadiazole |
| Nama Inggeris |
5-(bromomethyl)-2,1,3-benzoxadiazole; |
| MF |
C7H5BrN2O |
| Berat Molekul |
213.0314 |
| InChI |
InChI=1/C7H5BrN2O/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| CAS NO |
32863-31-3 |
| Struktur Molekul |
|
| Kepadatan |
1.742g/cm3 |
| Titik didih |
283.5°C at 760 mmHg |
| Indeks bias |
1.661 |
| Titik nyala |
125.3°C |
| Tekanan wap |
0.00538mmHg at 25°C |
| Cinta bahaya |
C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|