33018-91-6 Monoethylpimelate
Nama produk |
Monoethylpimelate |
Nama Inggeris |
Monoethylpimelate; Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin |
MF |
C9H16O4 |
Berat Molekul |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
CAS NO |
33018-91-6 |
EINECS |
251-346-6 |
Struktur Molekul |
|
Kepadatan |
1.074g/cm3 |
Titik didih |
288.7°C at 760 mmHg |
Indeks bias |
1.449 |
Titik nyala |
108°C |
Tekanan wap |
0.000581mmHg at 25°C |
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|