ChemNet > CAS > 344-14-9 dimethyl fluoromalonate
344-14-9 dimethyl fluoromalonate
Nama produk |
dimethyl fluoromalonate |
Sinonim |
Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
MF |
C5H7FO4 |
Berat Molekul |
150.1051 |
InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
CAS NO |
344-14-9 |
Struktur Molekul |
|
Kepadatan |
1.211g/cm3 |
Titik didih |
140.3°C at 760 mmHg |
Indeks bias |
1.382 |
Titik nyala |
38.4°C |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|