ChemNet > CAS > 384-67-8 Chlorodifluoroacetophenone
384-67-8 Chlorodifluoroacetophenone
Nama produk |
Chlorodifluoroacetophenone |
Sinonim |
2-Chloro-2,2-difluoro-1-phenylethanone; 2-Chloro-2,2-difluoroacetophenone; alpha-Chloro-alpha,alpha-difluoroacetophene; ethanone, 2-chloro-2,2-difluoro-1-phenyl-; GXFFVR; N-(2-fluorophenyl)-β-alanine; 2,2-Difluoro-2-chloroacetophenone; 2,2,2-Chlorodifluoroacetophenone |
MF |
C9H10FNO2 |
Berat Molekul |
183.1796 |
InChI |
InChI=1/C9H10FNO2/c10-7-3-1-2-4-8(7)11-6-5-9(12)13/h1-4,11H,5-6H2,(H,12,13) |
CAS NO |
384-67-8 |
Struktur Molekul |
|
Kepadatan |
1.301g/cm3 |
Titik didih |
357.2°C at 760 mmHg |
Indeks bias |
1.577 |
Titik nyala |
169.8°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|