394-35-4 methyl 2-fluorobenzoate
| Nama produk |
methyl 2-fluorobenzoate |
| Nama Inggeris |
methyl 2-fluorobenzoate; 2-Fluorobenzoic acid methyl ester |
| MF |
C8H7FO2 |
| Berat Molekul |
154.14 |
| InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| CAS NO |
394-35-4 |
| EINECS |
206-894-0 |
| Struktur Molekul |
|
| Kepadatan |
1.21 |
| Titik didih |
99℃ (18 torr) |
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|