ChemNet > CAS > 399-36-0 2',4'-Difluoroacetanilide
399-36-0 2',4'-Difluoroacetanilide
Nama produk |
2',4'-Difluoroacetanilide |
Sinonim |
2,4-Difluoroacetanilide; N-(2,4-difluorophenyl)acetamide |
MF |
C8H7F2NO |
Berat Molekul |
171.1441 |
InChI |
InChI=1/C8H7F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
CAS NO |
399-36-0 |
Struktur Molekul |
|
Kepadatan |
1.307g/cm3 |
Titik didih |
276.8°C at 760 mmHg |
Indeks bias |
1.531 |
Titik nyala |
121.2°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|