ChemNet > CAS > 4402-83-9 metil 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
4402-83-9 metil 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
| Nama produk |
metil 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate |
| Sinonim |
metil 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| Nama Inggeris |
methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate;methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| MF |
C12H9Cl2NO3 |
| Berat Molekul |
286.1108 |
| InChI |
InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| CAS NO |
4402-83-9 |
| Struktur Molekul |
|
| Kepadatan |
1.37g/cm3 |
| Titik lebur |
115℃ |
| Titik didih |
382.4°C at 760 mmHg |
| Indeks bias |
1.561 |
| Titik nyala |
185.1°C |
| Tekanan wap |
4.72E-06mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|