ChemNet > CAS > 51605-97-1 4-Amino-2-bromocumene
51605-97-1 4-Amino-2-bromocumene
Nama produk |
4-Amino-2-bromocumene |
Sinonim |
2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
MF |
C9H12BrN |
Berat Molekul |
214.1023 |
InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
CAS NO |
51605-97-1 |
Struktur Molekul |
|
Kepadatan |
1.355g/cm3 |
Titik didih |
271.8°C at 760 mmHg |
Indeks bias |
1.577 |
Titik nyala |
118.2°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|