ChemNet > CAS > 5312-97-0 2,5-Dimethoxybenzonitrile
5312-97-0 2,5-Dimethoxybenzonitrile
Nama produk |
2,5-Dimethoxybenzonitrile |
Nama Inggeris |
2,5-Dimethoxybenzonitrile;3-{3-methoxy-4-[(3-methylbenzyl)oxy]phenyl}-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
MF |
C26H23N3O2 |
Berat Molekul |
409.4797 |
InChI |
InChI=1/C26H23N3O2/c1-17-5-4-6-20(11-17)16-31-24-10-8-19(14-25(24)30-3)13-21(15-27)26-28-22-9-7-18(2)12-23(22)29-26/h4-14H,16H2,1-3H3,(H,28,29) |
CAS NO |
5312-97-0 |
EINECS |
226-169-2 |
Struktur Molekul |
|
Kepadatan |
1.23g/cm3 |
Titik lebur |
80-82℃ |
Titik didih |
638°C at 760 mmHg |
Indeks bias |
1.672 |
Titik nyala |
339.6°C |
Tekanan wap |
3.55E-16mmHg at 25°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|