ChemNet > CAS > 58452-00-9 3-Benzyloxy-4-methoxybenzoic acid
58452-00-9 3-Benzyloxy-4-methoxybenzoic acid
| Nama produk |
3-Benzyloxy-4-methoxybenzoic acid |
| Sinonim |
3-Benzyloxy-p-anisic acid |
| MF |
C15H14O4 |
| Berat Molekul |
258.2693 |
| InChI |
InChI=1/C15H14O4/c1-18-13-8-7-12(15(16)17)9-14(13)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,16,17) |
| CAS NO |
58452-00-9 |
| EINECS |
261-260-0 |
| Struktur Molekul |
|
| Kepadatan |
1.225g/cm3 |
| Titik didih |
416.6°C at 760 mmHg |
| Indeks bias |
1.589 |
| Titik nyala |
156°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
