ChemNet > CAS > 86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
Nama produk |
ethyl 2,4-dichloro-6-methylnicotinate |
Sinonim |
ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
MF |
C9H9Cl2NO2 |
Berat Molekul |
234.0793 |
InChI |
InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
CAS NO |
86129-63-7 |
Struktur Molekul |
|
Kepadatan |
1.32g/cm3 |
Titik lebur |
56℃ |
Titik didih |
298.2°C at 760 mmHg |
Indeks bias |
1.537 |
Titik nyala |
134.1°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|