ChemNet > CAS > 93-53-8 2-Phenylpropionaldehyde
93-53-8 2-Phenylpropionaldehyde
Nama produk |
2-Phenylpropionaldehyde |
Sinonim |
2-Phenylpropanal; alpha-methylphenylacetaldehyde; hydratopic aldehyde; Hydratropic aldehyde |
MF |
C9H10O |
Berat Molekul |
134.1751 |
InChI |
InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 |
CAS NO |
93-53-8 |
EINECS |
202-255-5 |
Struktur Molekul |
|
Kepadatan |
0.98g/cm3 |
Titik didih |
202.3°C at 760 mmHg |
Indeks bias |
1.505 |
Titik nyala |
76.1°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|