ChemNet > CAS > 1008-65-7 fenadiazole
1008-65-7 fenadiazole
Naam product |
fenadiazole |
Synoniemen |
2-(1,3,4-Oxadiazol-2-yl)phenol; 2-(o-Hydroxyphenyl)-1,3,4-oxadiazole; Eudormil; Hypnazol; Viodor; (6E)-6-(1,3,4-oxadiazol-2(3H)-ylidene)cyclohexa-2,4-dien-1-one; (6Z)-6-(1,3,4-oxadiazol-2(3H)-ylidene)cyclohexa-2,4-dien-1-one; 6-(1,3,4-oxadiazol-2(3H)-ylidene)cyclohexa-2,4-dien-1-one |
MF |
C8H6N2O2 |
Molecuulgewicht |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c11-7-4-2-1-3-6(7)8-10-9-5-12-8/h1-5,10H |
CAS-nummer |
1008-65-7 |
Moleculaire Structuur |
|
Dichtheid |
1.38g/cm3 |
Smeltpunt |
108℃ |
Kookpunt |
267.1°C at 760 mmHg |
Brekingsindex |
1.646 |
Vlampunt |
115.3°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|