1152-62-1 Z-L-methionine
| Naam product |
Z-L-methionine |
| Engelse naam |
Z-L-methionine; N-carbobenzyloxy-L-methionine; N-cbz-L-methionine; Z-Met-OH; N-Carbobenzoxy-L-methionine; CBZ-L-Methionine-OH; N-Benzyloxycarbonyl-L-methionine; N-[(benzyloxy)carbonyl]methionine; N-[(benzyloxy)carbonyl]-L-methionine; Cbz-L-methionine |
| MF |
C13H17NO4S |
| Molecuulgewicht |
283.3434 |
| InChI |
InChI=1/C13H17NO4S/c1-19-8-7-11(12(15)16)14-13(17)18-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,14,17)(H,15,16)/t11-/m0/s1 |
| CAS-nummer |
1152-62-1 |
| EINECS |
214-570-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.253g/cm3 |
| Smeltpunt |
66-70℃ |
| Kookpunt |
504.7°C at 760 mmHg |
| Brekingsindex |
1.567 |
| Vlampunt |
259°C |
| Dampdruk |
5.22E-11mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|