ChemNet > CAS > 126120-85-2 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
126120-85-2 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
Naam product |
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid |
MF |
C8H4F2O4 |
Molecuulgewicht |
202.1118 |
InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
CAS-nummer |
126120-85-2 |
Moleculaire Structuur |
|
Dichtheid |
1.66g/cm3 |
Kookpunt |
260.8°C at 760 mmHg |
Brekingsindex |
1.561 |
Vlampunt |
111.5°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|