ChemNet > CAS > 13099-95-1 2-Ethoxycarbonyl-3-coumaranone
13099-95-1 2-Ethoxycarbonyl-3-coumaranone
Naam product |
2-Ethoxycarbonyl-3-coumaranone |
Engelse naam |
2-Ethoxycarbonyl-3-coumaranone; 2H-Benzofuran-3-one-2-carboxylic acid ethyl ester~2-Carboethoxy-3-coumaranone~Ethyl 2H-benzofuran-3-one-2-carboxylate; ethyl 3-oxo-2,3-dihydro-1-benzofuran-2-carboxylate |
MF |
C11H10O4 |
Molecuulgewicht |
206.1947 |
InChI |
InChI=1/C11H10O4/c1-2-14-11(13)10-9(12)7-5-3-4-6-8(7)15-10/h3-6,10H,2H2,1H3 |
CAS-nummer |
13099-95-1 |
Moleculaire Structuur |
|
Dichtheid |
1.287g/cm3 |
Kookpunt |
324.4°C at 760 mmHg |
Brekingsindex |
1.551 |
Vlampunt |
143.8°C |
Dampdruk |
0.000246mmHg at 25°C |
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|