ChemNet > CAS > 15952-61-1 6-Chloro-3,4-methylenedioxy-benzaldehyde
15952-61-1 6-Chloro-3,4-methylenedioxy-benzaldehyde
| Naam product |
6-Chloro-3,4-methylenedioxy-benzaldehyde |
| Engelse naam |
6-Chloro-3,4-methylenedioxy-benzaldehyde; 6-Chloropiperonal; 6-Chloro-1,3-benzodioxole-5-carboxaldehyde~2-Chloro-4,5-(methylenedioxy)benzaldehyde; 6-chloro-1,3-benzodioxole-5-carbaldehyde |
| MF |
C8H5ClO3 |
| Molecuulgewicht |
184.5765 |
| InChI |
InChI=1/C8H5ClO3/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-3H,4H2 |
| CAS-nummer |
15952-61-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.485g/cm3 |
| Kookpunt |
295.5°C at 760 mmHg |
| Brekingsindex |
1.627 |
| Vlampunt |
138.1°C |
| Dampdruk |
0.00152mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|