ChemNet > CAS > 208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
Naam product |
(4-Methoxy-2-methylphenyl)boronic acid |
Synoniemen |
4-Methoxy-2-methylphenylboronic acid; 4-Methoxy-2-methylbenzeneboronic acid |
MF |
C8H11BO3 |
Molecuulgewicht |
165.9821 |
InChI |
InChI=1/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
CAS-nummer |
208399-66-0 |
Moleculaire Structuur |
|
Dichtheid |
1.14g/cm3 |
Kookpunt |
327.1°C at 760 mmHg |
Brekingsindex |
1.52 |
Vlampunt |
151.6°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|