ChemNet > CAS > 2150-89-2 N-(3-chloorfenyl)urethaan
2150-89-2 N-(3-chloorfenyl)urethaan
| Naam product |
N-(3-chloorfenyl)urethaan |
| Synoniemen |
Ethyl-3-chloorcarbanilaat~Ethyl-N-(3-chloorfenyl)carbamaat; ethyl(3-chloorfenyl)carbamaat |
| Engelse naam |
N-(3-Chlorophenyl)urethane; Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| MF |
C9H10ClNO2 |
| Molecuulgewicht |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS-nummer |
2150-89-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.268g/cm3 |
| Kookpunt |
238.5°C at 760 mmHg |
| Brekingsindex |
1.572 |
| Vlampunt |
98°C |
| Dampdruk |
0.0424mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|