2155-60-4 dibutyl itaconate
Naam product |
dibutyl itaconate |
Engelse naam |
dibutyl itaconate; Itaconic acid di-n-butyl ester; dibutyl 2-methylidenebutanedioate |
MF |
C13H22O4 |
Molecuulgewicht |
242.3114 |
InChI |
InChI=1/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
CAS-nummer |
2155-60-4 |
EINECS |
218-451-9 |
Moleculaire Structuur |
|
Dichtheid |
0.989g/cm3 |
Kookpunt |
307.4°C at 760 mmHg |
Brekingsindex |
1.446 |
Vlampunt |
142.2°C |
Dampdruk |
0.000728mmHg at 25°C |
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|