ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
Naam product |
4-Bromo-2-fluorobenzeneboronic acid |
Synoniemen |
4-Bromo-2-fluorophenylboronic acid |
MF |
C6H5BBrFO2 |
Molecuulgewicht |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
CAS-nummer |
216393-64-5 |
Moleculaire Structuur |
|
Dichtheid |
1.75g/cm3 |
Kookpunt |
310.6°C at 760 mmHg |
Brekingsindex |
1.571 |
Vlampunt |
141.6°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|