2307-10-0 S-n-Propyl thioacetate
Naam product |
S-n-Propyl thioacetate |
Engelse naam |
S-n-Propyl thioacetate; Thioacetic acid S-n-propyl ester; S-propyl ethanethioate; Propyl thioacetate |
MF |
C5H10OS |
Molecuulgewicht |
118.1973 |
InChI |
InChI=1/C5H10OS/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
CAS-nummer |
2307-10-0 |
EINECS |
218-984-7 |
Moleculaire Structuur |
|
Dichtheid |
0.967g/cm3 |
Kookpunt |
141.4°C at 760 mmHg |
Brekingsindex |
1.456 |
Vlampunt |
36°C |
Dampdruk |
5.87mmHg at 25°C |
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|