ChemNet > CAS > 23583-21-3 Benzylaminopropionicacidethylester
23583-21-3 Benzylaminopropionicacidethylester
Naam product |
Benzylaminopropionicacidethylester |
Engelse naam |
Benzylaminopropionicacidethylester; N-Benzyl-3-aminopropionic acid ethyl ester; N-Benzyl-beta-alanine ethyl ester; Bzl-beta-Ala-OEt~Ethyl 3-(benzylamino)propionate; ethyl N-benzyl-beta-alaninate; Ethyl 3-(Benzylamino)Propanoate |
MF |
C12H17NO2 |
Molecuulgewicht |
207.2689 |
InChI |
InChI=1/C12H17NO2/c1-2-15-12(14)8-9-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
CAS-nummer |
23583-21-3 |
EINECS |
245-759-0 |
Moleculaire Structuur |
|
Dichtheid |
1.033g/cm3 |
Kookpunt |
307.2°C at 760 mmHg |
Brekingsindex |
1.507 |
Vlampunt |
139.6°C |
Dampdruk |
0.000737mmHg at 25°C |
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|