ChemNet > CAS > 2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
Naam product |
Trimethyl 1,3,5-benzenetricarboxylate |
Synoniemen |
Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
MF |
C12H18O6 |
Molecuulgewicht |
258.2677 |
InChI |
InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
CAS-nummer |
2672-58-4 |
EINECS |
220-215-5 |
Moleculaire Structuur |
|
Dichtheid |
1.177g/cm3 |
Smeltpunt |
144-147℃ |
Kookpunt |
332.8°C at 760 mmHg |
Brekingsindex |
1.464 |
Vlampunt |
144.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|