ChemNet > CAS > 287917-97-9 4-bromo-1H-pyrazole-5-carbaldehyde
287917-97-9 4-bromo-1H-pyrazole-5-carbaldehyde
Naam product |
4-bromo-1H-pyrazole-5-carbaldehyde |
MF |
C4H3BrN2O |
Molecuulgewicht |
174.9834 |
InChI |
InChI=1/C4H3BrN2O/c5-3-1-6-7-4(3)2-8/h1-2H,(H,6,7) |
CAS-nummer |
287917-97-9 |
Moleculaire Structuur |
|
Dichtheid |
1.969g/cm3 |
Smeltpunt |
178℃ |
Kookpunt |
338.3°C at 760 mmHg |
Brekingsindex |
1.67 |
Vlampunt |
158.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|