ChemNet > CAS > 29636-87-1 4-(Hydroxymethyl)-5-methylimidazole hydrochloride
29636-87-1 4-(Hydroxymethyl)-5-methylimidazole hydrochloride
Naam product |
4-(Hydroxymethyl)-5-methylimidazole hydrochloride |
Synoniemen |
5-methyl-1h-imidazole-4-methano |
MF |
C5H8N2O |
Molecuulgewicht |
112.1298 |
InChI |
InChI=1/C5H8N2O/c1-4-5(2-8)7-3-6-4/h3,8H,2H2,1H3,(H,6,7) |
CAS-nummer |
29636-87-1 |
EINECS |
249-740-8 |
Moleculaire Structuur |
|
Dichtheid |
1.231g/cm3 |
Kookpunt |
389.1°C at 760 mmHg |
Brekingsindex |
1.574 |
Vlampunt |
189.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|