ChemNet > CAS > 29682-41-5 1,4-Dichloro-2-iodobenzene
29682-41-5 1,4-Dichloro-2-iodobenzene
Naam product |
1,4-Dichloro-2-iodobenzene |
Synoniemen |
2,5-Dichloroiodobenzene; ethyl 2-(methylsulfanyl)quinoline-1(2H)-carboxylate |
MF |
C6H3Cl2I |
Molecuulgewicht |
272.8985 |
InChI |
InChI=1/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
CAS-nummer |
29682-41-5 |
EINECS |
249-774-3 |
Moleculaire Structuur |
|
Dichtheid |
2.015g/cm3 |
Smeltpunt |
21-257℃ |
Kookpunt |
255.5°C at 760 mmHg |
Brekingsindex |
1.642 |
Vlampunt |
93.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|