ChemNet > CAS > 31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
31545-26-3 4-Chloro-3-nitrophenyl cyclopropyl ketone
Naam product |
4-Chloro-3-nitrophenyl cyclopropyl ketone |
Synoniemen |
(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
MF |
C10H8ClNO3 |
Molecuulgewicht |
225.6284 |
InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
CAS-nummer |
31545-26-3 |
EINECS |
250-690-4 |
Moleculaire Structuur |
|
Dichtheid |
1.464g/cm3 |
Smeltpunt |
78-80℃ |
Kookpunt |
333.4°C at 760 mmHg |
Brekingsindex |
1.631 |
Vlampunt |
155.4°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|