ChemNet > CAS > 31545-26-3 4-chloor-3-nitrofenylcyclopropylketon
31545-26-3 4-chloor-3-nitrofenylcyclopropylketon
| Naam product |
4-chloor-3-nitrofenylcyclopropylketon |
| Synoniemen |
(4-chloor-3-nitrofenyl) (cyclopropyl)methaan |
| Engelse naam |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| MF |
C10H8ClNO3 |
| Molecuulgewicht |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| CAS-nummer |
31545-26-3 |
| EINECS |
250-690-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.464g/cm3 |
| Smeltpunt |
78-80℃ |
| Kookpunt |
333.4°C at 760 mmHg |
| Brekingsindex |
1.631 |
| Vlampunt |
155.4°C |
| Dampdruk |
0.000137mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|