ChemNet > CAS > 31909-58-7 2-Furoylacetonitrile
31909-58-7 2-Furoylacetonitrile
Naam product |
2-Furoylacetonitrile |
Synoniemen |
3-(furan-2-yl)-3-oxopropanenitrile |
MF |
C7H5NO2 |
Molecuulgewicht |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS-nummer |
31909-58-7 |
Moleculaire Structuur |
|
Dichtheid |
1.188g/cm3 |
Smeltpunt |
76-83℃ |
Kookpunt |
297.2°C at 760 mmHg |
Brekingsindex |
1.494 |
Vlampunt |
133.6°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|