3345-50-4 N-Carbamoylmaleiimide
Naam product |
N-Carbamoylmaleiimide |
Engelse naam |
N-Carbamoylmaleiimide; N-Carbamoylmaleimide; 2,5-Dioxo-3-pyrroline-1-carboxamide~1H-Pyrrole-2,5-dione-1-carboxamide; 2,5-dioxo-2,5-dihydro-1H-pyrrole-1-carboxamide |
MF |
C5H4N2O3 |
Molecuulgewicht |
140.0969 |
InChI |
InChI=1/C5H4N2O3/c6-5(10)7-3(8)1-2-4(7)9/h1-2H,(H2,6,10) |
CAS-nummer |
3345-50-4 |
EINECS |
222-097-0 |
Moleculaire Structuur |
|
Dichtheid |
1.658g/cm3 |
Kookpunt |
307°C at 760 mmHg |
Brekingsindex |
1.628 |
Vlampunt |
139.5°C |
Dampdruk |
0.000744mmHg at 25°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|